krit.club logo

Aldehydes, Ketones and Carboxylic Acids - Methods of preparation

Grade 12ICSEChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Oxidation of Alcohols: Primary alcohols are oxidized to aldehydes using mild oxidizing agents like PCCPCC (Pyridinium chlorochromate) or CrO3CrO_3 in anhydrous media to prevent further oxidation to carboxylic acids. Secondary alcohols are oxidized to ketones using K2Cr2O7/H2SO4K_2Cr_2O_7/H_2SO_4 or KMnO4KMnO_4.

Rosenmund Reduction: Acid chlorides (RCOClR-COCl) are reduced to aldehydes by hydrogenating them over a catalyst of palladium (PdPd) supported on barium sulphate (BaSO4BaSO_4), which is 'poisoned' with sulfur or quinoline to prevent further reduction to alcohols.

Stephen Reaction: Nitriles (RCNR-CN) are reduced to corresponding imines with stannous chloride (SnCl2SnCl_2) in the presence of HClHCl, which on hydrolysis yield aldehydes.

Etard Reaction: Toluene (C6H5CH3C_6H_5CH_3) is oxidized to a chromium complex using chromyl chloride (CrO2Cl2CrO_2Cl_2) in CS2CS_2, which on hydrolysis gives benzaldehyde (C6H5CHOC_6H_5CHO).

Gatterman-Koch Reaction: Benzene or its derivatives react with carbon monoxide (COCO) and hydrogen chloride (HClHCl) in the presence of anhydrous AlCl3AlCl_3 or CuClCuCl to give benzaldehyde.

Preparation of Carboxylic Acids: Carboxylic acids can be prepared by the hydrolysis of nitriles (RCNR-CN) or amides (RCONH2R-CONH_2) in the presence of dilute mineral acids or alkalies as catalysts.

Grignard Reagent Method: Reaction of Grignard reagents (RMgXR-MgX) with dry ice (solid CO2CO_2) followed by hydrolysis yields carboxylic acids with one more carbon atom than the starting Grignard reagent.

📐Formulae

RCH2OHPCCRCHOR-CH_2OH \xrightarrow{PCC} R-CHO

RCOCl+H2PdBaSO4RCHO+HClR-COCl + H_2 \xrightarrow{Pd-BaSO_4} R-CHO + HCl

RCN+SnCl2+HClRCH=NHH3O+RCHOR-CN + SnCl_2 + HCl \longrightarrow R-CH=NH \xrightarrow{H_3O^+} R-CHO

C6H6+CO+HClAnhy. AlCl3/CuClC6H5CHOC_6H_6 + CO + HCl \xrightarrow{\text{Anhy. } AlCl_3/CuCl} C_6H_5CHO

RMgX+O=C=ODry etherRCOOMgXH3O+RCOOHR-MgX + O=C=O \xrightarrow{\text{Dry ether}} R-COOMgX \xrightarrow{H_3O^+} R-COOH

CH3CCH+H2OHg2+/H+,333KCH3COCH3CH_3-C \equiv CH + H_2O \xrightarrow{Hg^{2+}/H^+, 333K} CH_3-CO-CH_3

💡Examples

Problem 1:

Write the chemical equation for the preparation of Benzaldehyde from Toluene using Chromyl chloride.

Solution:

C6H5CH3+2CrO2Cl2CS2C6H5CH(OCrOHCl2)2H3O+C6H5CHOC_6H_5CH_3 + 2CrO_2Cl_2 \xrightarrow{CS_2} C_6H_5CH(OCrOHCl_2)_2 \xrightarrow{H_3O^+} C_6H_5CHO

Explanation:

This is known as the Etard reaction. Chromyl chloride oxidizes the methyl group to a brown chromium complex, which on subsequent hydrolysis yields benzaldehyde.

Problem 2:

How can Ethanoic acid be prepared from Methyl magnesium bromide?

Solution:

CH3MgBr+CO2dry etherCH3COOMgBrH+/H2OCH3COOH+Mg(OH)BrCH_3MgBr + CO_2 \xrightarrow{\text{dry ether}} CH_3COOMgBr \xrightarrow{H^+/H_2O} CH_3COOH + Mg(OH)Br

Explanation:

Methyl magnesium bromide (Grignard reagent) undergoes nucleophilic addition to the carbonyl carbon of CO2CO_2. The resulting adduct is hydrolyzed with dilute acid to produce Ethanoic acid.

Problem 3:

Complete the reaction: CH3CN(ii)H2O/H+(i)SnCl2+HCl?CH_3-C\equiv N \xrightarrow[(ii) H_2O/H^+]{(i) SnCl_2 + HCl} ?

Solution:

CH3CNSnCl2/HClCH3CH=NHH2O/H+CH3CHO+NH4ClCH_3-C\equiv N \xrightarrow{SnCl_2/HCl} CH_3-CH=NH \xrightarrow{H_2O/H^+} CH_3CHO + NH_4Cl

Explanation:

This is the Stephen reaction. Ethanenitrile is reduced to ethanimine (as hydrochloride salt), which then undergoes acid hydrolysis to form Ethanal (acetaldehyde).