krit.club logo

Organic Chemistry - Functional group chemistry

Grade 12IBChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

A homologous series is a series of compounds that can be represented by the same general formula, where each successive member differs by a CH2-CH_2- unit.

Alkanes undergo free-radical substitution reactions in the presence of UVUV light, involving three stages: initiation, propagation, and termination.

Alkenes are unsaturated hydrocarbons that undergo electrophilic addition reactions with halogens (X2X_2), hydrogen halides (HXHX), and water (H2OH_2O) in the presence of a catalyst like H2SO4H_2SO_4 or H3PO4H_3PO_4.

Primary alcohols are oxidized to aldehydes (RCHOR-CHO) and then to carboxylic acids (RCOOHR-COOH) using acidified potassium dichromate(VIVI) (K2Cr2O7/H+K_2Cr_2O_7/H^+). Secondary alcohols are oxidized to ketones (RCORR-CO-R).

Nucleophilic substitution reactions occur via SN1S_N1 (unimolecular, involving a carbocation intermediate, favored by tertiary halogenoalkanes) or SN2S_N2 (bimolecular, involving a transition state, favored by primary halogenoalkanes).

Esters are formed by the condensation reaction between a carboxylic acid and an alcohol in the presence of a concentrated sulfuric acid (H2SO4H_2SO_4) catalyst.

📐Formulae

CnH2n+2 (Alkanes)C_nH_{2n+2} \text{ (Alkanes)}

CnH2n (Alkenes)C_nH_{2n} \text{ (Alkenes)}

CnH2n+1OH (Alcohols)C_nH_{2n+1}OH \text{ (Alcohols)}

RCOOH+ROHH+RCOOR+H2O (Esterification)R-COOH + R'-OH \xrightarrow{H^+} R-COOR' + H_2O \text{ (Esterification)}

CH3CH2OH+[O]distillationCH3CHO+H2O (Partial Oxidation)CH_3CH_2OH + [O] \xrightarrow{\text{distillation}} CH_3CHO + H_2O \text{ (Partial Oxidation)}

Rate=k[RX][Nu] (SN2 kinetics)Rate = k[RX][Nu^-] \text{ (S}_N2 \text{ kinetics)}

Rate=k[RX] (SN1 kinetics)Rate = k[RX] \text{ (S}_N1 \text{ kinetics)}

💡Examples

Problem 1:

Determine the products formed when propan-1-ol is heated under reflux with an excess of acidified K2Cr2O7K_2Cr_2O_7. Provide the balanced chemical equation.

Solution:

CH3CH2CH2OH+2[O]H+/Cr2O72,refluxCH3CH2COOH+H2OCH_3CH_2CH_2OH + 2[O] \xrightarrow{H^+/Cr_2O_7^{2-}, \text{reflux}} CH_3CH_2COOH + H_2O

Explanation:

Propan-1-ol is a primary alcohol. Under reflux with excess oxidizing agent, it is fully oxidized from an aldehyde (propanal) to a carboxylic acid (propanoic acid). The color change observed is from orange (Cr2O72Cr_2O_7^{2-}) to green (Cr3+Cr^{3+}).

Problem 2:

Describe the mechanism of the reaction between chloromethane (CH3ClCH_3Cl) and aqueous sodium hydroxide (NaOHNaOH).

Solution:

CH3Cl+OH[HOCH3Cl]CH3OH+ClCH_3Cl + OH^- \rightarrow [HO\cdots CH_3 \cdots Cl]^{\ddagger} \rightarrow CH_3OH + Cl^-

Explanation:

This follows an SN2S_N2 mechanism because chloromethane is a primary halogenoalkane. The hydroxide ion (OHOH^-) acts as a nucleophile and attacks the electron-deficient carbon from the backside, leading to a transition state and inversion of configuration.

Problem 3:

Predict the major product of the addition of HBrHBr to propene (CH3CH=CH2CH_3CH=CH_2).

Solution:

CH3CH=CH2+HBrCH3CHBrCH3CH_3CH=CH_2 + HBr \rightarrow CH_3CHBrCH_3

Explanation:

According to Markovnikov's rule, the hydrogen atom from HBrHBr attaches to the carbon atom with the greater number of hydrogen atoms already attached (C1C_1), while the BrBr attaches to the more substituted carbon (C2C_2). This results in 22-bromopropane as the major product because it proceeds via a more stable secondary carbocation.

Functional group chemistry - Revision Notes & Key Formulas | IB Grade 12 Chemistry