krit.club logo

Acids and Bases - Acid deposition

Grade 11IBChemistry

Review the key concepts, formulae, and examples before starting your quiz.

πŸ”‘Concepts

β€’

Acid deposition refers to any form of precipitation (wet deposition like rain, snow, fog) or dry particles (dry deposition) with a pHpH lower than 5.65.6.

β€’

Natural rainwater is slightly acidic with a pHpH of approximately 5.65.6 due to the presence of dissolved carbon dioxide forming carbonic acid: CO2(g)+H2O(l)ightleftharpoonsH2CO3(aq)CO_2(g) + H_2O(l) ightleftharpoons H_2CO_3(aq).

β€’

Sulfur oxides (SOxSO_x) are major contributors, primarily from volcanic eruptions and the combustion of sulfur-containing fossil fuels. SO2SO_2 oxidizes to SO3SO_3, which reacts with water to form sulfuric acid (H2SO4H_2SO_4).

β€’

Nitrogen oxides (NOxNO_x) are formed during high-temperature combustion in internal combustion engines and by lightning. NO2NO_2 reacts with water to form nitric acid (HNO3HNO_3) and nitrous acid (HNO2HNO_2).

β€’

Environmental impacts include the leaching of essential nutrients like Mg2+Mg^{2+} and Ca2+Ca^{2+} from soil and the mobilization of toxic Al3+Al^{3+} ions into water systems, which damages fish gills.

β€’

Structural damage occurs when acid rain reacts with carbonate-based rocks (like limestone and marble), leading to the formation of soluble salts: CaCO3(s)+H2SO4(aq)oCaSO4(aq)+H2O(l)+CO2(g)CaCO_3(s) + H_2SO_4(aq) o CaSO_4(aq) + H_2O(l) + CO_2(g).

β€’

Methods to reduce SOxSO_x include pre-combustion techniques (hydrodesulfurization) and post-combustion techniques (flue-gas desulfurization using CaOCaO or CaCO3CaCO_3).

πŸ“Formulae

S(s)+O2(g)oSO2(g)S(s) + O_2(g) o SO_2(g)

2SO2(g)+O2(g)o2SO3(g)2SO_2(g) + O_2(g) o 2SO_3(g)

SO3(g)+H2O(l)oH2SO4(aq)SO_3(g) + H_2O(l) o H_2SO_4(aq)

N2(g)+O2(g)o2NO(g)N_2(g) + O_2(g) o 2NO(g)

2NO(g)+O2(g)o2NO2(g)2NO(g) + O_2(g) o 2NO_2(g)

2NO2(g)+H2O(l)oHNO3(aq)+HNO2(aq)2NO_2(g) + H_2O(l) o HNO_3(aq) + HNO_2(aq)

4NO2(g)+2H2O(l)+O2(g)o4HNO3(aq)4NO_2(g) + 2H_2O(l) + O_2(g) o 4HNO_3(aq)

πŸ’‘Examples

Problem 1:

Calculate the effect of acid rain on a statue made of calcium carbonate. Write the balanced equation for the reaction with nitric acid (HNO3HNO_3).

Solution:

CaCO3(s)+2HNO3(aq)oCa(NO3)2(aq)+H2O(l)+CO2(g)CaCO_3(s) + 2HNO_3(aq) o Ca(NO_3)_2(aq) + H_2O(l) + CO_2(g)

Explanation:

Nitric acid reacts with the solid calcium carbonate to form aqueous calcium nitrate, liquid water, and carbon dioxide gas. This process dissolves the statue over time, a process known as chemical weathering.

Problem 2:

Explain how hydrodesulfurization reduces acid deposition.

Solution:

Rβˆ’S+H2oRβˆ’H+H2SR-S + H_2 o R-H + H_2S

Explanation:

This is a pre-combustion method where sulfur is removed from refined petroleum fractions by reacting it with hydrogen over a catalyst. The resulting H2SH_2S is then removed, preventing the formation of SO2SO_2 when the fuel is eventually burned.

Acid deposition - Revision Notes & Key Formulas | IB Grade 11 Chemistry