krit.club logo

Chemistry - Carbon and its Compounds (Allotropes, Carbon Dioxide, Methane)

Grade 8ICSE

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Allotropy is the phenomenon where an element exists in two or more forms that have different physical properties but identical chemical properties. Carbon exhibits this through crystalline and amorphous forms.

Crystalline allotropes of Carbon include Diamond (hardest natural substance, 3D tetrahedral structure), Graphite (soft, slippery, hexagonal layers, good conductor), and Fullerenes (e.g., C60C_{60} or Buckminsterfullerene).

Amorphous allotropes of Carbon include Coal, Coke, Charcoal, and Lampblack. They do not have a defined internal geometric structure.

Carbon Dioxide (CO2CO_2) is a colorless, odorless gas. It is non-combustible and does not support combustion. It is heavier than air and slightly soluble in water, forming carbonic acid (H2CO3H_2CO_3).

Methane (CH4CH_4), commonly known as 'Marsh Gas,' is the simplest hydrocarbon. It is a major component of Natural Gas and Biogas, possessing a tetrahedral molecular geometry.

Tetravalency and Catenation: Carbon has a valency of 4 (TetravalencyTetravalency) and the unique ability to link with other carbon atoms to form long chains or rings (CatenationCatenation).

Greenhouse Effect: Gases like CO2CO_2 and CH4CH_4 trap solar heat in the Earth's atmosphere, contributing to global warming.

📐Formulae

CO2CO_2

CH4CH_4

CaCO3+2HClCaCl2+H2O+CO2CaCO_3 + 2HCl \rightarrow CaCl_2 + H_2O + CO_2 \uparrow

Ca(OH)2+CO2CaCO3+H2OCa(OH)_2 + CO_2 \rightarrow CaCO_3 \downarrow + H_2O

CH4+2O2CO2+2H2O+HeatCH_4 + 2O_2 \rightarrow CO_2 + 2H_2O + \text{Heat}

CO2+H2OH2CO3CO_2 + H_2O \rightleftharpoons H_2CO_3

2C+O2 (limited)2CO2C + O_2 \text{ (limited)} \rightarrow 2CO

💡Examples

Problem 1:

What is observed when Carbon Dioxide gas is passed through lime water for a short duration, and what happens if it is passed in excess?

Solution:

Lime water turns milky initially; the milkiness disappears with excess CO2CO_2.

Explanation:

Initially, insoluble Calcium Carbonate (CaCO3CaCO_3) forms. With excess CO2CO_2, it reacts further to form soluble Calcium Bicarbonate (Ca(HCO3)2Ca(HCO_3)_2), making the solution clear again.

Problem 2:

Compare the electrical conductivity of Diamond and Graphite.

Solution:

Diamond is a non-conductor, whereas Graphite is a good conductor of electricity.

Explanation:

In Diamond, all four valence electrons of Carbon are involved in strong covalent bonds. In Graphite, each Carbon is bonded to only three others, leaving one 'free' or delocalized electron per atom to carry charge.

Problem 3:

Calculate the molecular mass of Methane (CH4CH_4). (Atomic mass: C=12,H=1C=12, H=1)

Solution:

16 u16 \text{ u}

Explanation:

Molecular mass = (1×Mass of C)+(4×Mass of H)=(1×12)+(4×1)=12+4=16(1 \times \text{Mass of C}) + (4 \times \text{Mass of H}) = (1 \times 12) + (4 \times 1) = 12 + 4 = 16.

Carbon and its Compounds (Allotropes, Carbon Dioxide, Methane) Revision - Class 8 Science ICSE