krit.club logo

Air and Atmosphere - Composition of Air

Grade 7ICSE

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Air is a mixture of gases, primarily composed of Nitrogen (N2N_2), Oxygen (O2O_2), Carbon dioxide (CO2CO_2), Water vapor (H2OH_2O), and noble gases like Argon (ArAr).

Nitrogen (N2N_2) makes up about 78%78\% of the air. It is relatively inactive and helps in controlling the rate of combustion.

Oxygen (O2O_2) makes up about 21%21\% of the air. It is vital for respiration in living organisms and is a supporter of combustion.

Carbon dioxide (CO2CO_2) is present in a very small amount (approx 0.03%0.03\% to 0.04%0.04\%). It is essential for photosynthesis and contributes to the greenhouse effect.

The presence of water vapor (H2OH_2O) in the atmosphere is responsible for weather phenomena and determines the humidity of a place.

Noble gases like Argon (ArAr), Helium (HeHe), and Neon (NeNe) are present in traces, making up about 0.9%0.9\% of the atmosphere.

Air also contains varying amounts of dust particles, smoke, and pollutants depending on the location and environment.

📐Formulae

Composition of Nitrogen (N2)78%\text{Composition of Nitrogen } (N_2) \approx 78\%

Composition of Oxygen (O2)21%\text{Composition of Oxygen } (O_2) \approx 21\%

Composition of Carbon dioxide (CO2)0.03%0.04%\text{Composition of Carbon dioxide } (CO_2) \approx 0.03\% - 0.04\%

6CO2+6H2OSunlight/ChlorophyllC6H12O6+6O26CO_2 + 6H_2O \xrightarrow{\text{Sunlight/Chlorophyll}} C_6H_{12}O_6 + 6O_2

C6H12O6+6O26CO2+6H2O+EnergyC_6H_{12}O_6 + 6O_2 \rightarrow 6CO_2 + 6H_2O + \text{Energy}

💡Examples

Problem 1:

Calculate the approximate volume of Oxygen (O2O_2) present in a cylinder containing 500 L500\text{ L} of air.

Solution:

VO2=21100×500=105 LV_{O_2} = \frac{21}{100} \times 500 = 105\text{ L}

Explanation:

Since Oxygen (O2O_2) constitutes approximately 21%21\% of the total volume of air, we multiply the total volume by 0.210.21.

Problem 2:

What happens when a burning candle is covered with a glass jar?

Solution:

The candle flickers and eventually goes out because the supply of Oxygen (O2O_2) is exhausted.

Explanation:

Combustion requires O2O_2. Once the O2O_2 inside the jar is consumed and converted into CO2CO_2, the chemical reaction supporting the flame stops.

Problem 3:

Identify the gas that turns lime water milky and write the chemical equation.

Solution:

Carbon dioxide (CO2CO_2). Equation: Ca(OH)2+CO2CaCO3+H2OCa(OH)_2 + CO_2 \rightarrow CaCO_3 + H_2O

Explanation:

When CO2CO_2 is passed through lime water (Calcium hydroxide), it reacts to form Calcium carbonate (CaCO3CaCO_3), which is an insoluble white precipitate that makes the water look milky.