krit.club logo

Human Body - The Respiratory System

Grade 6ICSE

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Respiration is a biochemical process where food (glucose) is oxidized to release energy in the form of ATP. The general equation is C6H12O6+6O26CO2+6H2O+EnergyC_6H_{12}O_6 + 6O_2 \rightarrow 6CO_2 + 6H_2O + \text{Energy}.

Breathing is the physical process of inhaling air rich in O2O_2 and exhaling air rich in CO2CO_2.

The human respiratory tract consists of the nostrils, nasal cavity, pharynx, larynx, trachea, bronchi, bronchioles, and alveoli.

The trachea or windpipe is held open by 'C' shaped cartilaginous rings to prevent it from collapsing.

Alveoli are tiny balloon-like structures where the actual exchange of gases (O2O_2 and CO2CO_2) takes place through the process of diffusion.

The diaphragm is a large, dome-shaped muscular sheet that separates the thoracic cavity from the abdominal cavity.

During inhalation, the diaphragm contracts and moves downwards, and the ribs move upwards and outwards, increasing the volume of the chest cavity and lowering the air pressure inside.

During exhalation, the diaphragm relaxes and moves upwards, and the ribs move downwards and inwards, decreasing the volume and increasing the air pressure to push air out.

📐Formulae

C6H12O6+6O26CO2+6H2O+Energy (ATP)C_6H_{12}O_6 + 6O_2 \rightarrow 6CO_2 + 6H_2O + \text{Energy (ATP)}

Breathing Rate=Total number of breathsTotal time in minutes\text{Breathing Rate} = \frac{\text{Total number of breaths}}{\text{Total time in minutes}}

💡Examples

Problem 1:

What happens when exhaled air is passed through lime water? Write the chemical notation for the change.

Solution:

The lime water turns milky.

Explanation:

Exhaled air contains a high concentration of CO2CO_2. When CO2CO_2 reacts with lime water (Ca(OH)2Ca(OH)_2), it forms an insoluble white precipitate of calcium carbonate (CaCO3CaCO_3), making the water appear milky: Ca(OH)2+CO2CaCO3+H2OCa(OH)_2 + CO_2 \rightarrow CaCO_3 + H_2O.

Problem 2:

Calculate the breathing rate of a person who breathes 7575 times in 55 minutes.

Solution:

15 breaths/minute15 \text{ breaths/minute}

Explanation:

Using the formula Breathing Rate=Total breathsTotal time\text{Breathing Rate} = \frac{\text{Total breaths}}{\text{Total time}}, we get 755=15\frac{75}{5} = 15.

Problem 3:

Explain the role of O2O_2 in cellular respiration.

Solution:

Oxidation of Glucose.

Explanation:

In the presence of O2O_2, glucose (C6H12O6C_6H_{12}O_6) is broken down into CO2CO_2 and H2OH_2O to release the energy required for cellular activities.

The Respiratory System - Revision Notes & Key Formulas | ICSE Class 6 Science