krit.club logo

Chemistry of the Environment - Water

Grade 12IGCSEChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Chemical tests for water: Anhydrous copper(II) sulfate turns from white to blue (CuSO4+5H2OCuSO45H2OCuSO_{4} + 5H_{2}O \rightarrow CuSO_{4} \cdot 5H_{2}O) and anhydrous cobalt(II) chloride turns from blue to pink (CoCl2+6H2OCoCl26H2OCoCl_{2} + 6H_{2}O \rightarrow CoCl_{2} \cdot 6H_{2}O).

Purity of water: A chemical test only confirms the presence of water. To confirm purity, the substance must have a fixed boiling point of 100C100^\circ C and a melting point of 0C0^\circ C at standard atmospheric pressure.

Water Treatment: The process includes sedimentation (to remove large particles), filtration (through layers of sand and gravel to remove smaller insoluble solids), use of carbon (to remove tastes and odors), and chlorination (to kill bacteria and microbes using Cl2Cl_{2}).

Dissolved substances: Water in nature contains dissolved oxygen (O2O_{2}) for aquatic life, metal ions (such as Ca2+Ca^{2+}, Mg2+Mg^{2+}, and Na+Na^{+}), and pollutants like nitrates (NO3NO_{3}^{-}) and phosphates (PO43PO_{4}^{3-}) from fertilizers.

Eutrophication: The process where excess nutrients (NO3NO_{3}^{-} and PO43PO_{4}^{3-}) lead to rapid algae growth, blocking light and leading to oxygen depletion in water bodies as bacteria decompose dead algae.

Desalination: The removal of excess salts from seawater to produce potable water, typically through distillation or reverse osmosis.

📐Formulae

CuSO4(s)+5H2O(l)CuSO45H2O(s)CuSO_{4}(s) + 5H_{2}O(l) \rightarrow CuSO_{4} \cdot 5H_{2}O(s)

CoCl2(s)+6H2O(l)CoCl26H2O(s)CoCl_{2}(s) + 6H_{2}O(l) \rightarrow CoCl_{2} \cdot 6H_{2}O(s)

Cl2(g)+H2O(l)HCl(aq)+HClO(aq)Cl_{2}(g) + H_{2}O(l) \rightarrow HCl(aq) + HClO(aq)

💡Examples

Problem 1:

A student has a colorless liquid and adds a few drops to a sample of anhydrous CuSO4CuSO_{4}. The solid turns blue. Does this prove the liquid is pure water?

Solution:

No, it only proves that water is present.

Explanation:

The change from white to blue in anhydrous CuSO4CuSO_{4} is a chemical test for the presence of water (H2OH_{2}O). To prove it is pure, the student must measure its boiling point; if it boils exactly at 100C100^\circ C, it is pure.

Problem 2:

Explain the role of chlorine (Cl2Cl_{2}) in the water treatment process and write why it is essential for human consumption.

Solution:

Chlorine is used for sterilization.

Explanation:

Chlorine (Cl2Cl_{2}) reacts with water to form hypochlorous acid, which acts as a disinfectant. This step is crucial because it kills pathogenic bacteria and viruses that cause diseases like cholera and typhoid, making the water safe to drink.

Problem 3:

Describe how the runoff of fertilizers containing NH4NO3NH_{4}NO_{3} into a lake leads to a decrease in dissolved O2O_{2} levels.

Solution:

The process is called eutrophication.

Explanation:

Fertilizers provide excess nitrates (NO3NO_{3}^{-}) which cause an 'algal bloom'. The thick layer of algae blocks sunlight, causing underwater plants to die. Decomposer bacteria then break down the dead plant matter, consuming the dissolved O2O_{2} in the water through aerobic respiration, leading to the death of fish and other aquatic organisms.