krit.club logo

Organic Compounds Containing Nitrogen - Identification of primary, secondary and tertiary amines

Grade 12ICSEChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Amines are classified as primary (11^\circ), secondary (22^\circ), or tertiary (33^\circ) based on the number of alkyl or aryl groups attached to the nitrogen atom.

Hinsberg's Test: This is the most important chemical test to distinguish between the three types of amines. It uses Benzenesulfonyl chloride (C6H5SO2ClC_6H_5SO_2Cl) as the reagent in the presence of an alkali like NaOHNaOH.

Reaction with Nitrous Acid (HNO2HNO_2): This test differentiates amines based on the nature of the products formed (evolution of N2N_2 gas, formation of yellow oily nitroso compounds, or diazonium salts).

Carbylamine Test: This test is specific ONLY to primary amines (both aliphatic and aromatic). It involves heating the amine with chloroform (CHCl3CHCl_3) and alcoholic KOHKOH to produce foul-smelling isocyanides (RNCRNC).

Azo-dye Test: Used to identify aromatic primary amines (like aniline). It involves the reaction of a diazonium salt with β\beta-naphthol in alkaline conditions to form a bright orange/red dye.

Reaction with Mustard Oil (Hofmann Mustard Oil Reaction): Primary amines react with carbon disulfide (CS2CS_2) and mercuric chloride (HgCl2HgCl_2) to give alkyl isothiocyanates (RNCSRNCS) which have a pungent smell like mustard oil.

📐Formulae

RNH2+C6H5SO2ClOH[C6H5SO2NR]Na+ (Soluble in alkali)R-NH_2 + C_6H_5SO_2Cl \xrightarrow{OH^-} [C_6H_5SO_2NR]^-Na^+ \text{ (Soluble in alkali)}

R2NH+C6H5SO2ClOHC6H5SO2NR2 (Insoluble precipitate)R_2NH + C_6H_5SO_2Cl \xrightarrow{OH^-} C_6H_5SO_2NR_2 \text{ (Insoluble precipitate)}

RNH2+CHCl3+3KOHΔRNC+3KCl+3H2ORNH_2 + CHCl_3 + 3KOH \xrightarrow{\Delta} R-NC + 3KCl + 3H_2O

RNH2+HNO2NaNO2/HClROH+N2+H2OR-NH_2 + HNO_2 \xrightarrow{NaNO_2/HCl} R-OH + N_2\uparrow + H_2O

C6H5NH2+NaNO2+2HCl273278K[C6H5N2]+Cl+NaCl+2H2OC_6H_5NH_2 + NaNO_2 + 2HCl \xrightarrow{273-278 K} [C_6H_5N_2]^+Cl^- + NaCl + 2H_2O

R2NH+HNO2R2NN=O+H2O (Yellow oily liquid)R_2NH + HNO_2 \rightarrow R_2N-N=O + H_2O \text{ (Yellow oily liquid)}

💡Examples

Problem 1:

How can you chemically distinguish between Ethylamine (CH3CH2NH2CH_3CH_2NH_2) and Diethylamine ((CH3CH2)2NH(CH_3CH_2)_2NH)?

Solution:

Use the Hinsberg's Test or the Carbylamine Test.

Explanation:

  1. In Hinsberg's Test: Ethylamine (primary) reacts with C6H5SO2ClC_6H_5SO_2Cl to form NN-ethylbenzenesulfonamide, which is soluble in NaOHNaOH. Diethylamine (secondary) reacts to form N,NN,N-diethylbenzenesulfonamide, which remains insoluble in NaOHNaOH. 2. In Carbylamine Test: Ethylamine gives a foul smell of ethyl isocyanide (C2H5NCC_2H_5NC) when heated with CHCl3/KOHCHCl_3/KOH, while diethylamine does not respond to this test.

Problem 2:

Describe a test to distinguish between Aniline (C6H5NH2C_6H_5NH_2) and NN-methylaniline (C6H5NHCH3C_6H_5NHCH_3).

Solution:

The Azo-dye test or Carbylamine test can be used.

Explanation:

Aniline is a primary aromatic amine. It undergoes diazotization with NaNO2/HClNaNO_2/HCl at 05C0-5^\circ C to form a diazonium salt, which then reacts with β\beta-naphthol to form a brilliant orange-red dye. NN-methylaniline is a secondary amine; it does not form a diazonium salt and therefore does not give the azo-dye test. Additionally, Aniline gives the Carbylamine test, while NN-methylaniline does not.

Problem 3:

What happens when Trimethylamine ((CH3)3N(CH_3)_3N) is treated with Benzenesulfonyl chloride?

Solution:

No reaction occurs in the presence of alkali.

Explanation:

Tertiary amines like (CH3)3N(CH_3)_3N do not have a replaceable hydrogen atom on the nitrogen. While they may form an unstable salt with C6H5SO2ClC_6H_5SO_2Cl, the salt is hydrolyzed back in the presence of aqueous alkali (NaOHNaOH). Thus, practically, no visible reaction is observed.