krit.club logo

Haloalkanes and Haloarenes - Methods of preparation

Grade 12ICSEChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Preparation from Alcohols: Alcohols react with halogen acids (HXHX), phosphorus halides (PCl3PCl_3, PCl5PCl_5), or thionyl chloride (SOCl2SOCl_2) to form haloalkanes. Thionyl chloride is preferred because the byproducts SO2SO_2 and HClHCl are gases and escape easily.

Free Radical Halogenation: Alkanes react with Cl2Cl_2 or Br2Br_2 in the presence of UV light or heat. This usually results in a complex mixture of mono-, di-, and polyhaloalkanes.

Electrophilic Substitution: Haloarenes are prepared by the halogenation of aromatic hydrocarbons in the presence of Lewis acid catalysts like FeFe or FeCl3FeCl_3 in the dark.

Addition to Alkenes: Hydrohalic acids (HXHX) add to alkenes. Symmetrical alkenes give one product, while unsymmetrical alkenes follow Markovnikov's Rule (the halogen attaches to the carbon with fewer hydrogen atoms).

Anti-Markovnikov Addition (Peroxide Effect): In the presence of organic peroxides, the addition of HBrHBr (not HClHCl or HIHI) to unsymmetrical alkenes occurs contrary to Markovnikov's rule.

Finkelstein Reaction: Used specifically for preparing iodoalkanes by reacting alkyl chlorides/bromides with NaINaI in dry acetone.

Swarts Reaction: Used for preparing fluoroalkanes by heating alkyl chlorides/bromides in the presence of metallic fluorides like AgFAgF, Hg2F2Hg_2F_2, or SbF3SbF_3.

Sandmeyer Reaction: Primary aromatic amines react with NaNO2+HClNaNO_2 + HCl at 273278K273-278 K to form diazonium salts, which then react with Cu2Cl2Cu_2Cl_2 or Cu2Br2Cu_2Br_2 to form haloarenes.

📐Formulae

ROH+SOCl2RCl+SO2+HClR-OH + SOCl_2 \rightarrow R-Cl + SO_2 \uparrow + HCl \uparrow

CH3CH=CH2+HBrMarkovnikovCH3CH(Br)CH3CH_3-CH=CH_2 + HBr \xrightarrow{Markovnikov} CH_3-CH(Br)-CH_3

CH3CH=CH2+HBrPeroxideCH3CH2CH2BrCH_3-CH=CH_2 + HBr \xrightarrow{Peroxide} CH_3-CH_2-CH_2Br

RX+NaIAcetoneRI+NaX (where X=Cl,Br)R-X + NaI \xrightarrow{Acetone} R-I + NaX \text{ (where } X = Cl, Br)

2CH3Br+Hg2F22CH3F+Hg2Br22CH_3-Br + Hg_2F_2 \rightarrow 2CH_3-F + Hg_2Br_2

C6H5N2+ClCu2Cl2/HClC6H5Cl+N2C_6H_5N_2^+Cl^- \xrightarrow{Cu_2Cl_2/HCl} C_6H_5Cl + N_2

💡Examples

Problem 1:

Identify the major product formed when Prop-1-ene reacts with HBrHBr in the absence of peroxide.

Solution:

The product is 22-Bromopropane.

Explanation:

According to Markovnikov's Rule, the negative part of the addendum (BrBr^-) attaches to the doubly bonded carbon atom carrying the lesser number of hydrogen atoms. Thus, CH3CH=CH2+HBrCH3CH(Br)CH3CH_3-CH=CH_2 + HBr \rightarrow CH_3-CH(Br)-CH_3.

Problem 2:

Write the chemical equation for the preparation of Chloroethane from Ethanol using PCl5PCl_5.

Solution:

CH3CH2OH+PCl5CH3CH2Cl+POCl3+HClCH_3CH_2OH + PCl_5 \rightarrow CH_3CH_2Cl + POCl_3 + HCl

Explanation:

Alcohols react with Phosphorus pentachloride to yield alkyl chlorides, phosphorus oxychloride, and hydrogen chloride.

Problem 3:

How is Iodobenzene prepared from Benzenediazonium chloride?

Solution:

C6H5N2+Cl+KIC6H5I+KCl+N2C_6H_5N_2^+Cl^- + KI \rightarrow C_6H_5I + KCl + N_2

Explanation:

Unlike chloro and bromoarenes, iodobenzene is prepared simply by shaking the diazonium salt solution with potassium iodide (KIKI); it does not require cuprous halides.