krit.club logo

Alcohols, Phenols and Ethers - Physical and chemical properties

Grade 12ICSEChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

The boiling points of alcohols and phenols are significantly higher than those of hydrocarbons, ethers, and haloalkanes of comparable molecular masses due to the presence of intermolecular HH-bonding.

Solubility of alcohols in water decreases with the increase in the size of the alkyl or aryl group because the non-polar hydrophobic part dominates.

Phenols are more acidic than alcohols because the phenoxide ion (C6H5OC_6H_5O^-) is stabilized by resonance, whereas the alkoxide ion (ROR-O^-) is destabilized by the +I+I effect of the alkyl group.

The Lucas Test distinguishes 1,2,1^\circ, 2^\circ, and 33^\circ alcohols using anhydrous ZnCl2ZnCl_2 and conc. HClHCl. 33^\circ alcohols give immediate turbidity, 22^\circ within 5 minutes, and 11^\circ only upon heating.

The Reimer-Tiemann reaction involves the treatment of phenol with chloroform (CHCl3CHCl_3) in the presence of sodium hydroxide to introduce an aldehyde group at the ortho position, forming Salicylaldehyde.

Kolbe's Reaction involves the treatment of phenoxide ion with CO2CO_2 followed by acidification to produce Salicylic acid (2-hydroxybenzoic acid).

Ethers have lower boiling points than isomeric alcohols because they cannot form intermolecular HH-bonding with themselves.

Cleavage of ethers by hydrohalic acids (HXHX): Simple ethers react via SN2S_N2 mechanism, where the halide ion attacks the smaller alkyl group. However, if a 33^\circ alkyl group is present, the reaction proceeds via SN1S_N1 mechanism.

📐Formulae

ROH+HXZnCl2RX+H2OR-OH + HX \xrightarrow{ZnCl_2} R-X + H_2O

C6H5OH+CHCl3+3NaOH343KC6H4(OH)CHO+3NaCl+2H2OC_6H_5OH + CHCl_3 + 3NaOH \xrightarrow{343K} C_6H_4(OH)CHO + 3NaCl + 2H_2O

C6H5ONa+CO2413K,47atmC6H4(OH)COONaH+C6H4(OH)COOHC_6H_5ONa + CO_2 \xrightarrow{413K, 4-7 atm} C_6H_4(OH)COONa \xrightarrow{H^+} C_6H_4(OH)COOH

RX+RONa+ROR+NaXR-X + R'-O^-Na^+ \rightarrow R-O-R' + NaX

CH3CH2OHconc.H2SO4,443KCH2=CH2+H2OCH_3CH_2OH \xrightarrow{conc. H_2SO_4, 443K} CH_2=CH_2 + H_2O

3ROH+PCl33RCl+H3PO33R-OH + PCl_3 \rightarrow 3R-Cl + H_3PO_3

💡Examples

Problem 1:

Predict the products of the reaction of anisoie (C6H5OCH3C_6H_5OCH_3) with HIHI.

Solution:

C6H5OCH3+HIC6H5OH+CH3IC_6H_5OCH_3 + HI \rightarrow C_6H_5OH + CH_3I

Explanation:

The reaction occurs via SN2S_N2 mechanism. The nucleophile II^- attacks the smaller methyl group because the C6H5OC_6H_5-O bond has partial double bond character due to resonance, making it stronger and harder to break than the OCH3O-CH_3 bond.

Problem 2:

Write the chemical equation for the nitration of phenol with dilute HNO3HNO_3 at low temperature (298K298 K).

Solution:

C6H5OHdil.HNO3,298Konitrophenol+pnitrophenolC_6H_5OH \xrightarrow{dil. HNO_3, 298K} o-nitrophenol + p-nitrophenol

Explanation:

Phenol is highly reactive towards electrophilic substitution. Dilute HNO3HNO_3 gives a mixture of ortho and para isomers. The ortho isomer can be separated from the para isomer by steam distillation due to intramolecular HH-bonding in oo-nitrophenol.

Problem 3:

How can you distinguish between Ethanol and Phenol using a chemical test?

Solution:

Neutral FeCl3FeCl_3 test.

Explanation:

Phenol reacts with neutral ferric chloride to give a violet-colored complex: 6C6H5OH+FeCl3[Fe(OC6H5)6]3+3H++3Cl6C_6H_5OH + FeCl_3 \rightarrow [Fe(OC_6H_5)_6]^{3-} + 3H^+ + 3Cl^-. Ethanol does not give this color reaction.