krit.club logo

Periodicity - Periodic trends

Grade 12IBChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Effective Nuclear Charge (ZeffZ_{eff}): The net positive charge experienced by valence electrons. It is calculated as Zeff=ZSZ_{eff} = Z - S, where ZZ is the atomic number and SS is the number of shielding (inner) electrons. ZeffZ_{eff} increases across a period but remains relatively constant down a group.

Atomic Radius: The distance from the nucleus to the outermost electron shell. It decreases across a period due to increasing ZeffZ_{eff} pulling electrons closer, and increases down a group due to the addition of new principal energy levels (nn).

Ionic Radius: Cations (Mn+M^{n+}) are always smaller than their parent atoms because the loss of electrons reduces repulsion and often removes an entire outer shell. Anions (AnA^{n-}) are always larger than their parent atoms because added electrons increase inter-electronic repulsion, expanding the electron cloud.

First Ionization Energy (IE1IE_1): The energy required to remove one mole of electrons from one mole of gaseous atoms: X(g)X+(g)+eX(g) \rightarrow X^+(g) + e^-. It increases across a period and decreases down a group, with notable exceptions at Group 13 (dropping from s2s^2 to p1p^1) and Group 16 (electron pairing repulsion).

Electronegativity: A dimensionless quantity (Pauling scale) representing the ability of an atom to attract a shared pair of electrons in a covalent bond. Fluorine (FF) is the most electronegative element (4.04.0). It increases across a period and decreases down a group.

Electron Affinity (EeaE_{ea}): The energy change when one mole of electrons is added to one mole of gaseous atoms: X(g)+eX(g)X(g) + e^- \rightarrow X^-(g). Values generally become more exothermic (more negative) across a period as ZeffZ_{eff} increases.

Metallic Character: The tendency of an element to lose electrons and form positive ions. It decreases across a period and increases down a group. Oxides of metals are generally basic (e.g., Na2ONa_2O, MgOMgO), while oxides of non-metals are acidic (e.g., P4O10P_4O_{10}, SO3SO_3).

📐Formulae

Zeff=ZSZ_{eff} = Z - S

X(g)X+(g)+e(ΔH=IE1)X(g) \rightarrow X^+(g) + e^- \quad (\Delta H = IE_1), where IE1>0IE_1 > 0

X(g)+eX(g)(ΔH=EA1)X(g) + e^- \rightarrow X^-(g) \quad (\Delta H = EA_1), where EA1<0EA_1 < 0 (usually)

M2O(s)+H2O(l)2MOH(aq)M_2O(s) + H_2O(l) \rightarrow 2MOH(aq) (Basic Oxide Reaction)

XOn(s)+H2O(l)HmXOn+1(aq)XO_n(s) + H_2O(l) \rightarrow H_mXO_{n+1}(aq) (Acidic Oxide Reaction)

💡Examples

Problem 1:

Explain why the first ionization energy of Aluminum (Z=13Z=13) is lower than that of Magnesium (Z=12Z=12), despite the general trend of increasing ionization energy across Period 3.

Solution:

Mg:[Ne]3s2Mg: [Ne] 3s^2 vs. Al:[Ne]3s23p1Al: [Ne] 3s^2 3p^1.

Explanation:

In Magnesium, the electron is removed from a stable, full 3s3s subshell. In Aluminum, the electron is removed from the 3p3p subshell, which is at a higher energy level and is better shielded by the 3s3s electrons. This makes the 3p3p electron easier to remove, resulting in a lower IE1IE_1 for AlAl than for MgMg.

Problem 2:

Arrange the following species in order of increasing radius: ClCl^-, ArAr, K+K^+.

Solution:

K+<Ar<ClK^+ < Ar < Cl^-

Explanation:

These species are isoelectronic, meaning they all have 1818 electrons (1s22s22p63s23p61s^2 2s^2 2p^6 3s^2 3p^6). The radius is determined by the nuclear charge (ZZ). K+K^+ has Z=19Z=19, ArAr has Z=18Z=18, and ClCl^- has Z=17Z=17. The higher nuclear charge in K+K^+ pulls the electrons more strongly, making it the smallest, while the lower charge in ClCl^- results in the largest radius.

Problem 3:

Write the balanced chemical equation for the reaction of Phosphorus(V) oxide with water and identify the nature of the product.

Solution:

P4O10(s)+6H2O(l)4H3PO4(aq)P_4O_{10}(s) + 6H_2O(l) \rightarrow 4H_3PO_4(aq)

Explanation:

Phosphorus is a non-metal, so its oxide is acidic. P4O10P_4O_{10} reacts with water to form phosphoric(V) acid (H3PO4H_3PO_4), which dissociates to release H+H^+ ions, resulting in a solution with a pH<7pH < 7.

Periodic trends - Revision Notes & Key Formulas | IB Grade 12 Chemistry