krit.club logo

Periodicity - Periodic table

Grade 12IBChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

The Periodic Table is arranged by increasing atomic number (ZZ). Periods are horizontal rows (indicating the number of occupied main energy levels), and Groups are vertical columns (elements with the same number of valence electrons and similar chemical properties).

Elements are categorized into blocks: ss, pp, dd, and ff, representing the sub-shell being filled by the valence electrons.

Effective Nuclear Charge (ZeffZ_{eff}) is the net positive charge experienced by valence electrons. It increases across a period because the number of protons increases while inner-shell shielding remains constant. It remains approximately constant down a group.

Atomic Radius: Decreases across a period due to increased ZeffZ_{eff} pulling electrons closer to the nucleus. Increases down a group as more main energy levels are added.

Ionic Radius: Cations (M+M^+) are smaller than their parent atoms because they lose electrons and often an entire outer energy level. Anions (XX^-) are larger than their parent atoms due to increased electron-electron repulsion with the same nuclear charge.

First Ionization Energy (IE1IE_1): The energy required to remove one mole of electrons from one mole of gaseous atoms: X(g)X+(g)+eX(g) \rightarrow X^+(g) + e^-. It increases across a period and decreases down a group.

Electronegativity: The measure of an atom's ability to attract a shared pair of electrons in a covalent bond. Trends follow IE1IE_1, increasing across a period and decreasing down a group.

Electron Affinity: The energy change when one mole of electrons is added to one mole of gaseous atoms: X(g)+eX(g)X(g) + e^- \rightarrow X^-(g). Most elements have an exothermic first electron affinity.

Oxide Trends (Period 3): Oxides transition from basic (Na2ONa_2O, MgOMgO) to amphoteric (Al2O3Al_2O_3) to acidic (SiO2SiO_2, P4O10P_4O_{10}, SO2/SO3SO_2/SO_3, Cl2O7Cl_2O_7).

📐Formulae

Zeff=ZSZ_{eff} = Z - S

X(g)X+(g)+eX(g) \rightarrow X^{+}(g) + e^{-}

X(g)+eX(g)X(g) + e^{-} \rightarrow X^{-}(g)

Na2O(s)+H2O(l)2NaOH(aq)Na_2O(s) + H_2O(l) \rightarrow 2NaOH(aq)

P4O10(s)+6H2O(l)4H3PO4(aq)P_4O_{10}(s) + 6H_2O(l) \rightarrow 4H_3PO_4(aq)

Al2O3(s)+6HCl(aq)2AlCl3(aq)+3H2O(l)Al_2O_3(s) + 6HCl(aq) \rightarrow 2AlCl_3(aq) + 3H_2O(l)

Al2O3(s)+2NaOH(aq)+3H2O(l)2Na[Al(OH)4](aq)Al_2O_3(s) + 2NaOH(aq) + 3H_2O(l) \rightarrow 2Na[Al(OH)_4](aq)

💡Examples

Problem 1:

Explain why the first ionization energy of sulfur (SS) is lower than that of phosphorus (PP), despite sulfur having a higher atomic number.

Solution:

Sulfur has an electron configuration of [Ne]3s23p4[Ne] 3s^2 3p^4, whereas phosphorus is [Ne]3s23p3[Ne] 3s^2 3p^3.

Explanation:

In phosphorus, the three 3p3p electrons are all unpaired in separate orbitals. In sulfur, the fourth 3p3p electron must pair up with another electron in one of the 3p3p orbitals. The inter-electron repulsion between the two electrons in the same orbital makes it easier to remove one of them, resulting in a lower IE1IE_1 for SS compared to PP.

Problem 2:

Arrange the following isoelectronic species in order of decreasing ionic radius: Mg2+Mg^{2+}, Na+Na^{+}, FF^{-}, O2O^{2-}.

Solution:

O2>F>Na+>Mg2+O^{2-} > F^{-} > Na^{+} > Mg^{2+}

Explanation:

All four ions have the same electron configuration (1s22s22p61s^2 2s^2 2p^6). The radius is determined by the nuclear charge (ZZ). Mg2+Mg^{2+} has the highest ZZ (1212), pulling the electrons closest, while O2O^{2-} has the lowest ZZ (88), allowing the electron cloud to be more spread out.