krit.club logo

Organic Chemistry - Carboxylic acids (Ethanoic acid)

Grade 11IGCSEChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Carboxylic acids are a homologous series of organic compounds characterized by the carboxyl functional group, written as COOH-COOH.

The general formula for the carboxylic acid homologous series is CnH2n+1COOHC_nH_{2n+1}COOH. For ethanoic acid, n=1n=1, giving the formula CH3COOHCH_3COOH.

Ethanoic acid is a weak acid, meaning it only partially dissociates in aqueous solution: CH3COOH(aq)ightleftharpoonsCH3COO(aq)+H+(aq)CH_3COOH(aq) ightleftharpoons CH_3COO^-(aq) + H^+(aq).

Ethanoic acid can be prepared by the oxidation of ethanol using an oxidizing agent like acidified potassium manganate(VII) (KMnO4KMnO_4) or through bacterial oxidation (vinegar production).

Carboxylic acids react with alcohols in the presence of an acid catalyst (usually concentrated H2SO4H_2SO_4) to form esters and water in a process called esterification.

Ethanoic acid reacts with metals to form a salt (ethanoate) and hydrogen gas, and with carbonates to form a salt, water, and carbon dioxide gas.

📐Formulae

CnH2n+1COOHC_n H_{2n+1} COOH

CH3CH2OH+2[O]CH3COOH+H2OCH_3CH_2OH + 2[O] \rightarrow CH_3COOH + H_2O

CH3COOH+NaOHCH3COONa+H2OCH_3COOH + NaOH \rightarrow CH_3COONa + H_2O

2CH3COOH+Na2CO32CH3COONa+H2O+CO22CH_3COOH + Na_2CO_3 \rightarrow 2CH_3COONa + H_2O + CO_2

CH3COOH+C2H5OHCH3COOC2H5+H2OCH_3COOH + C_2H_5OH \rightleftharpoons CH_3COOC_2H_5 + H_2O

💡Examples

Problem 1:

Write the balanced chemical equation for the reaction between ethanoic acid (CH3COOHCH_3COOH) and magnesium (MgMg).

Solution:

2CH3COOH+Mg(CH3COO)2Mg+H22CH_3COOH + Mg \rightarrow (CH_3COO)_2Mg + H_2

Explanation:

Ethanoic acid reacts with reactive metals like magnesium to produce a salt (magnesium ethanoate) and hydrogen gas. Because the ethanoate ion CH3COOCH_3COO^- has a charge of 1-1 and the magnesium ion Mg2+Mg^{2+} has a charge of +2+2, two ethanoate ions are required for every magnesium ion.

Problem 2:

Identify the products formed when ethanoic acid reacts with ethanol in the presence of concentrated sulfuric acid.

Solution:

Ethyl ethanoate (CH3COOCH2CH3) and water (H2O)Ethyl\ ethanoate\ (CH_3COOCH_2CH_3)\ and\ water\ (H_2O)

Explanation:

This is an esterification reaction. The hydroxyl group (OH-OH) from the acid and the hydrogen (H-H) from the alcohol's functional group combine to form H2OH_2O, while the remaining fragments join to form the ester, ethyl ethanoate.

Carboxylic acids (Ethanoic acid) Revision - Grade 11 Chemistry IGCSE