krit.club logo

Chemical Reactions - Reversible reactions and dynamic equilibrium

Grade 11IGCSEChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

A reversible reaction is one where the products can react together to reform the original reactants. It is represented by the symbol \rightleftharpoons.

Dynamic equilibrium occurs in a closed system when the rate of the forward reaction equals the rate of the reverse reaction, and the concentrations of reactants and products remain constant.

Le Chatelier’s Principle states that if a change (concentration, temperature, or pressure) is applied to a system at equilibrium, the system will shift its position to counteract the change.

Increasing the temperature favors the endothermic reaction (ΔH>0\Delta H > 0) to absorb the extra heat.

Decreasing the temperature favors the exothermic reaction (ΔH<0\Delta H < 0) to release more heat.

Increasing the pressure favors the side with the fewer number of gaseous molecules to reduce the pressure.

Increasing the concentration of a reactant will shift the equilibrium to the right to produce more products.

A catalyst increases the rate of both forward and reverse reactions equally; it helps reach equilibrium faster but does not change the position of the equilibrium or the yield.

📐Formulae

N2(g)+3H2(g)2NH3(g)ΔH=92 kJ/molN_2(g) + 3H_2(g) \rightleftharpoons 2NH_3(g) \quad \Delta H = -92\text{ kJ/mol}

2SO2(g)+O2(g)2SO3(g)ΔH=197 kJ/mol2SO_2(g) + O_2(g) \rightleftharpoons 2SO_3(g) \quad \Delta H = -197\text{ kJ/mol}

CuSO45H2O(s)CuSO4(s)+5H2O(l)CuSO_4 \cdot 5H_2O(s) \rightleftharpoons CuSO_4(s) + 5H_2O(l)

H2O(l)H+(aq)+OH(aq)H_2O(l) \rightleftharpoons H^+(aq) + OH^-(aq)

💡Examples

Problem 1:

Predict the effect on the yield of NH3NH_3 in the Haber process reaction N2(g)+3H2(g)2NH3(g)N_2(g) + 3H_2(g) \rightleftharpoons 2NH_3(g) if the pressure is increased.

Solution:

The yield of NH3NH_3 will increase.

Explanation:

According to Le Chatelier’s Principle, increasing pressure shifts the equilibrium to the side with fewer gas molecules. The reactant side has 1+3=41 + 3 = 4 moles of gas, while the product side has 22 moles of gas. Therefore, the equilibrium shifts to the right (the product side).

Problem 2:

In the exothermic reaction 2SO2(g)+O2(g)2SO3(g)2SO_2(g) + O_2(g) \rightleftharpoons 2SO_3(g), what happens to the equilibrium position if the temperature is increased?

Solution:

The equilibrium position shifts to the left (towards the reactants).

Explanation:

Since the forward reaction is exothermic (releases heat), increasing the temperature causes the system to favor the endothermic reverse reaction to absorb the added thermal energy. This results in a lower yield of SO3SO_3.

Problem 3:

Explain why a catalyst is used in the Contact Process if it does not increase the yield of SO3SO_3.

Solution:

A catalyst is used to increase the rate of reaction.

Explanation:

While a catalyst does not shift the position of equilibrium, it provides an alternative pathway with a lower activation energy (EaE_a). This allows the system to reach the state of dynamic equilibrium much faster, making the industrial process more time-efficient.

Reversible reactions and dynamic equilibrium Revision - Grade 11 Chemistry IGCSE