krit.club logo

Chemical Energetics - Energy level diagrams

Grade 11IGCSEChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Chemical Energetics involves the study of energy changes during chemical reactions, primarily as heat energy.

In an Exothermic reaction, heat energy is released to the surroundings. The enthalpy of the products is lower than the enthalpy of the reactants, resulting in a negative enthalpy change: ΔH<0\Delta H < 0.

In an Endothermic reaction, heat energy is absorbed from the surroundings. The enthalpy of the products is higher than the enthalpy of the reactants, resulting in a positive enthalpy change: ΔH>0\Delta H > 0.

The Activation Energy (EaE_a) is the minimum energy required for a collision between particles to result in a chemical reaction. On a diagram, it is the energy gap between the reactants and the peak of the energy curve.

Bond Breaking is an endothermic process (requires energy, +ΔH+\Delta H), while Bond Making is an exothermic process (releases energy, ΔH-\Delta H).

An Energy Level Diagram (or Reaction Profile) shows the relative enthalpies of reactants and products and the energy barrier (EaE_a) that must be overcome.

📐Formulae

ΔH=HproductsHreactants\Delta H = H_{products} - H_{reactants}

ΔH=Energy absorbed to break bondsEnergy released to form bonds\Delta H = \text{Energy absorbed to break bonds} - \text{Energy released to form bonds}

Q=mcΔTQ = mc\Delta T

💡Examples

Problem 1:

The combustion of methane is represented by the equation: CH4(g)+2O2(g)CO2(g)+2H2O(l)CH_4(g) + 2O_2(g) \rightarrow CO_2(g) + 2H_2O(l) with ΔH=890 kJ/mol\Delta H = -890\text{ kJ/mol}. Describe the energy level diagram for this reaction.

Solution:

The reactants (CH4+2O2CH_4 + 2O_2) are placed at a higher energy level than the products (CO2+2H2OCO_2 + 2H_2O). A curve rises from the reactant level to a peak (representing EaE_a) and then drops significantly to the product level. The downward arrow from reactants to products indicates ΔH=890 kJ/mol\Delta H = -890\text{ kJ/mol}.

Explanation:

Because ΔH\Delta H is negative, the reaction is exothermic. Energy is lost to the surroundings, meaning the chemical system loses potential energy, placing products 'lower' on the graph than reactants.

Problem 2:

Calculate the enthalpy change (ΔH\Delta H) for the reaction H2+Cl22HClH_2 + Cl_2 \rightarrow 2HCl given the bond energies: HH=436 kJ/molH-H = 436\text{ kJ/mol}, ClCl=242 kJ/molCl-Cl = 242\text{ kJ/mol}, and HCl=431 kJ/molH-Cl = 431\text{ kJ/mol}. Determine if it is endothermic or exothermic.

Solution:

Energy to break bonds=436+242=678 kJ/mol\text{Energy to break bonds} = 436 + 242 = 678\text{ kJ/mol} Energy released making bonds=2×431=862 kJ/mol\text{Energy released making bonds} = 2 \times 431 = 862\text{ kJ/mol} ΔH=678862=184 kJ/mol\Delta H = 678 - 862 = -184\text{ kJ/mol}

Explanation:

Since ΔH\Delta H is negative (184 kJ/mol-184\text{ kJ/mol}), the reaction is exothermic. More energy is released during the formation of HClH-Cl bonds than is required to break the HHH-H and ClClCl-Cl bonds.

Energy level diagrams - Revision Notes & Key Formulas | IGCSE Grade 11 Chemistry