krit.club logo

s-Block Elements - Anomalous Properties of Lithium and Beryllium

Grade 11ICSEChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Lithium (LiLi) and Beryllium (BeBe) are the first elements of Group 1 and Group 2 respectively, and they exhibit properties that differ significantly from the rest of their groups due to their exceptionally small atomic and ionic sizes.

The anomalous behavior is attributed to: (i) Small size of atom and ion, (ii) High electronegativity and high ionization enthalpy, (iii) High polarizing power (Charge/Radius ratio), and (iv) Absence of dd-orbitals in their valence shell.

Lithium's polarizing power is high, leading to a significant covalent character in its compounds (e.g., LiClLiCl is soluble in organic solvents).

Lithium is the only alkali metal which reacts directly with nitrogen to form a nitride: 6Li+N22Li3N6Li + N_2 \rightarrow 2Li_3N.

Lithium carbonate (Li2CO3Li_2CO_3) and lithium nitrate (LiNO3LiNO_3) are thermally unstable; LiNO3LiNO_3 decomposes to give Li2OLi_2O, NO2NO_2, and O2O_2, while other alkali metal nitrates give nitrites and O2O_2.

Beryllium forms compounds that are largely covalent, such as BeCl2BeCl_2 which has a polymeric chain structure in the solid state.

Beryllium oxide (BeOBeO) and beryllium hydroxide (Be(OH)2Be(OH)_2) are amphoteric, reacting with both acids and bases, whereas oxides/hydroxides of other Group 2 elements are basic.

Diagonal Relationship: Lithium shows similarities with Magnesium (MgMg) of Group 2, and Beryllium shows similarities with Aluminum (AlAl) of Group 13 due to similar ionic sizes and charge/radius ratios.

The maximum coordination number for BeBe is 4 due to the presence of only four available orbitals (one 2s2s and three 2p2p), whereas other members can have higher coordination numbers using dd-orbitals.

📐Formulae

Li2CO3ΔLi2O+CO2Li_2CO_3 \xrightarrow{\Delta} Li_2O + CO_2

4LiNO3Δ2Li2O+4NO2+O24LiNO_3 \xrightarrow{\Delta} 2Li_2O + 4NO_2 + O_2

Be(OH)2+2OH[Be(OH)4]2 (Beryllate ion)Be(OH)_2 + 2OH^- \rightarrow [Be(OH)_4]^{2-} \text{ (Beryllate ion)}

Be(OH)2+2HClBeCl2+2H2OBe(OH)_2 + 2HCl \rightarrow BeCl_2 + 2H_2O

Polarizing PowerIonic ChargeIonic Radius\text{Polarizing Power} \propto \frac{\text{Ionic Charge}}{\text{Ionic Radius}}

💡Examples

Problem 1:

Explain why LiClLiCl is soluble in organic solvents like ethanol, whereas NaClNaCl is not.

Solution:

Due to the very small size of the Li+Li^+ ion, it has high polarizing power. This leads to a high degree of covalent character in the LiClLi-Cl bond (Fajans' Rules). NaClNaCl, having a larger Na+Na^+ ion, is predominantly ionic. Since 'like dissolves like', the covalent LiClLiCl dissolves in organic (covalent) solvents.

Explanation:

Covalent character in ionic compounds is determined by the polarization of the anion by the cation.

Problem 2:

Write the chemical equations for the reaction of BeOBeO with HClHCl and NaOHNaOH.

Solution:

BeO+2HClBeCl2+H2OBeO + 2HCl \rightarrow BeCl_2 + H_2O BeO+2NaOH+H2ONa2[Be(OH)4]BeO + 2NaOH + H_2O \rightarrow Na_2[Be(OH)_4]

Explanation:

These reactions demonstrate the amphoteric nature of Beryllium oxide, as it reacts with both a strong acid (HClHCl) and a strong base (NaOHNaOH).

Problem 3:

Compare the thermal stability of Li2CO3Li_2CO_3 and Na2CO3Na_2CO_3.

Solution:

Li2CO3Li_2CO_3 decomposes on heating: Li2CO3ΔLi2O+CO2Li_2CO_3 \xrightarrow{\Delta} Li_2O + CO_2. Na2CO3Na_2CO_3 is thermally stable and does not decompose at moderate temperatures.

Explanation:

The Li+Li^+ ion is very small and polarizes the large CO32CO_3^{2-} ion, weakening the COC-O bond and making it easier to form the more stable Li2OLi_2O lattice.

Anomalous Properties of Lithium and Beryllium Revision - Class 11 Chemistry ICSE