krit.club logo

Hydrocarbons - Alkenes and Alkynes

Grade 11ICSEChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Alkenes are unsaturated hydrocarbons containing at least one carbon-carbon double bond (C=CC=C). Their general formula is CnH2nC_nH_{2n}.

Alkynes are unsaturated hydrocarbons containing at least one carbon-carbon triple bond (CC-C \equiv C-). Their general formula is CnH2n2C_nH_{2n-2}.

In alkenes, the double-bonded carbon atoms are sp2sp^2 hybridized, resulting in a trigonal planar geometry with bond angles of approximately 120120^\circ.

In alkynes, the triple-bonded carbon atoms are spsp hybridized, resulting in a linear geometry with bond angles of 180180^\circ.

Geometrical Isomerism (ciscis-transtrans isomerism) occurs in alkenes due to restricted rotation around the C=CC=C bond. It requires each carbon of the double bond to be attached to two different groups.

Markovnikov's Rule: During the addition of a polar reagent (like HBrHBr) to an unsymmetrical alkene, the negative part of the reagent (nucleophile) attaches to the carbon atom containing the lesser number of hydrogen atoms.

Kharasch Effect (Peroxide Effect): In the presence of organic peroxides, the addition of HBrHBr (only HBrHBr) to unsymmetrical alkenes follows Anti-Markovnikov orientation.

Acidity of Alkynes: Terminal alkynes (e.g., HCCHHC \equiv CH) are weakly acidic because the spsp hybridized carbon has 50%50\% ss-character, making it highly electronegative and able to stabilize the conjugate base.

Ozonolysis: The process where alkenes or alkynes react with O3O_3 followed by reductive cleavage (with Zn/H2OZn/H_2O) to form carbonyl compounds (aldehydes or ketones). This is used to locate the position of the multiple bond.

📐Formulae

CnH2n (General formula for Alkenes)C_nH_{2n} \text{ (General formula for Alkenes)}

CnH2n2 (General formula for Alkynes)C_nH_{2n-2} \text{ (General formula for Alkynes)}

CH3CH=CH2+HBrCH3CH(Br)CH3 (Markovnikov Addition)CH_3-CH=CH_2 + HBr \rightarrow CH_3-CH(Br)-CH_3 \text{ (Markovnikov Addition)}

CH3CH=CH2+HBrPeroxideCH3CH2CH2Br (Anti-Markovnikov Addition)CH_3-CH=CH_2 + HBr \xrightarrow{\text{Peroxide}} CH_3-CH_2-CH_2Br \text{ (Anti-Markovnikov Addition)}

CaC2+2H2OCa(OH)2+C2H2 (Preparation of Ethyne)CaC_2 + 2H_2O \rightarrow Ca(OH)_2 + C_2H_2 \text{ (Preparation of Ethyne)}

n(CH2=CH2)High P, T(CH2CH2)n (Polymerization)n(CH_2=CH_2) \xrightarrow{\text{High P, T}} \text{---}(CH_2-CH_2)\text{---}_n \text{ (Polymerization)}

💡Examples

Problem 1:

An alkene 'A' on ozonolysis gives a mixture of ethanol (CH3CHOCH_3CHO) and propanone (CH3COCH3CH_3COCH_3). Identify the structure and IUPAC name of 'A'.

Solution:

CH3CH=C(CH3)2CH_3-CH=C(CH_3)_2 (2-Methylbut-2-ene)

Explanation:

To find the alkene, remove the oxygen atoms from the two carbonyl products and join the carbon atoms with a double bond. CH3CH=OCH_3-CH=O and O=C(CH3)2O=C(CH_3)_2 become CH3CH=C(CH3)2CH_3-CH=C(CH_3)_2.

Problem 2:

How can you distinguish between Ethene (C2H4C_2H_4) and Ethyne (C2H2C_2H_2) using a chemical test?

Solution:

Use Ammoniacal Silver Nitrate (TollensReagentTollen's Reagent).

Explanation:

Ethyne, being a terminal alkyne, reacts with ammoniacal silver nitrate to form a white precipitate of silver acetylide (AgCCAgAg-C \equiv C-Ag). Ethene does not react as it lacks acidic hydrogens.

Problem 3:

Convert 1-Bromopropane to Propene.

Solution:

CH3CH2CH2Br+alc. KOHΔCH3CH=CH2+KBr+H2OCH_3CH_2CH_2Br + \text{alc. } KOH \xrightarrow{\Delta} CH_3CH=CH_2 + KBr + H_2O

Explanation:

This is a dehydrohalogenation reaction (eta-elimination) where an alcoholic solution of potassium hydroxide acts as a strong base to remove HBrHBr.

Alkenes and Alkynes - Revision Notes & Key Formulas | ICSE Class 11 Chemistry