krit.club logo

Periodicity - The periodic table

Grade 11IBChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

The Periodic Table is arranged by increasing atomic number (ZZ). Horizontal rows are called periods and vertical columns are called groups.

Elements in the same group have the same number of valence electrons and share similar chemical properties. For example, Group 1 elements have a valence configuration of ns1ns^1.

Effective Nuclear Charge (ZeffZ_{eff}): This is the net positive charge experienced by valence electrons. It increases across a period because the number of protons increases while the inner-shell shielding remains relatively constant.

Atomic Radius: Decreases across a period (due to increasing ZeffZ_{eff} pulling electrons closer) and increases down a group (due to the addition of new principal energy levels, nn).

Ionic Radius: Cations (Mn+M^{n+}) are always smaller than their parent atoms because they lose electrons and sometimes an entire outer shell. Anions (XnX^{n-}) are always larger than their parent atoms due to increased electron-electron repulsion.

First Ionization Energy (IE1IE_1): The energy required to remove one mole of electrons from one mole of gaseous atoms. It generally increases across a period and decreases down a group.

Electronegativity: A measure of the ability of an atom at attract a bonding pair of electrons in a covalent bond. It increases across a period and decreases down a group. Fluorine (FF) is the most electronegative element.

Electron Affinity: The energy change when one mole of electrons is added to one mole of gaseous atoms. It generally becomes more exothermic (more negative) across a period.

Metallic Character: Decreases across a period and increases down a group. Metals generally have low IEIE and low electronegativity, tending to form cations.

Oxide Periodicity: Across Period 3, oxides transition from basic (Na2ONa_2O, MgOMgO), to amphoteric (Al2O3Al_2O_3), to acidic (SiO2SiO_2, P4O10P_4O_{10}, SO3SO_3, Cl2O7Cl_2O_7).

📐Formulae

X(g)X+(g)+e(First Ionization Energy)X(g) \rightarrow X^+(g) + e^- \quad (\text{First Ionization Energy})

X(g)+eX(g)(First Electron Affinity)X(g) + e^- \rightarrow X^-(g) \quad (\text{First Electron Affinity})

Zeff=ZS(where S is the shielding constant)Z_{eff} = Z - S \quad (\text{where } S \text{ is the shielding constant})

2Li(s)+2H2O(l)2LiOH(aq)+H2(g)(Alkali Metal + Water)2Li(s) + 2H_2O(l) \rightarrow 2LiOH(aq) + H_2(g) \quad (\text{Alkali Metal + Water})

Cl2(aq)+2KI(aq)2KCl(aq)+I2(aq)(Halogen Displacement)Cl_2(aq) + 2KI(aq) \rightarrow 2KCl(aq) + I_2(aq) \quad (\text{Halogen Displacement})

💡Examples

Problem 1:

Explain why the first ionization energy of Sulfur (SS) is lower than that of Phosphorus (PP), despite Sulfur being further to the right in Period 3.

Solution:

Phosphorus has an electron configuration of [Ne]3s23p3[Ne] 3s^2 3p^3, where the 3p3p subshell is half-filled (one electron in each orbital). Sulfur has a configuration of [Ne]3s23p4[Ne] 3s^2 3p^4.

Explanation:

In Sulfur, the fourth 3p3p electron must pair up with another electron in a 3p3p orbital. This creates inter-electron repulsion, which makes it easier to remove the electron compared to the stable, half-filled subshell of Phosphorus. Therefore, the IE1IE_1 of SS is lower.

Problem 2:

Arrange the following species in order of increasing radius: Mg2+Mg^{2+}, FF^-, Na+Na^+.

Solution:

Mg2+<Na+<FMg^{2+} < Na^+ < F^-

Explanation:

These are isoelectronic species, meaning they all have the same number of electrons (1010 electrons, configuration 1s22s22p61s^2 2s^2 2p^6). The radius depends on the number of protons (ZZ). Mg2+Mg^{2+} has 1212 protons, Na+Na^+ has 1111, and FF^- has 99. The higher the atomic number, the stronger the nuclear pull on the same number of electrons, resulting in a smaller radius.

Problem 3:

Predict the acid-base nature of the product formed when P4O10P_4O_{10} reacts with water and write the equation.

Solution:

The product is H3PO4H_3PO_4 (phosphoric acid), which is acidic. Equation: P4O10(s)+6H2O(l)4H3PO4(aq)P_4O_{10}(s) + 6H_2O(l) \rightarrow 4H_3PO_4(aq).

Explanation:

Non-metal oxides are generally acidic. When they react with water, they form oxyacids. P4O10P_4O_{10} is a typical acidic oxide from the right side of Period 3.

The periodic table - Revision Notes & Key Formulas | IB Grade 11 Chemistry