krit.club logo

Periodicity - Periodic trends

Grade 11IBChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Effective Nuclear Charge (ZeffZ_{eff}): The net positive charge experienced by valence electrons. It is calculated as Zeff=ZSZ_{eff} = Z - S, where ZZ is the atomic number and SS is the number of shielding electrons. ZeffZ_{eff} increases across a period but remains relatively constant down a group.

Atomic Radius: The distance from the nucleus to the outermost electron shell. It decreases across a period due to increasing ZeffZ_{eff} pulling electrons closer, and increases down a group due to the addition of new principal energy levels (nn).

Ionic Radius: Cations (e.g., Na+Na^{+}) are smaller than their parent atoms because they lose an electron shell and have increased ZeffZ_{eff}. Anions (e.g., ClCl^{-}) are larger than their parent atoms due to increased inter-electron repulsion in the valence shell.

First Ionization Energy (IE1IE_1): The energy required to remove one mole of electrons from one mole of gaseous atoms to form one mole of gaseous 1+1+ ions. Trend: Increases across a period, decreases down a group.

Electronegativity: A relative measure of the attraction an atom has for a shared pair of electrons in a covalent bond. Trends follow the ZeffZ_{eff} pattern, peaking at Fluorine (FF).

Electron Affinity (EAEA): The energy change when one mole of electrons is added to one mole of gaseous atoms. Values generally become more exothermic (more negative) across a period.

Melting Points: Depend on the type of bonding. In Period 3, melting points increase from NaNa to AlAl (metallic bonding strength), peak at SiSi (giant covalent structure), and then drop for P4P_4, S8S_8, Cl2Cl_2 (weak London dispersion forces).

Oxide Periodicity: Period 3 oxides transition from basic (Na2ONa_2O, MgOMgO) to amphoteric (Al2O3Al_2O_3) to acidic (SiO2SiO_2, P4O10P_4O_{10}, SO3SO_3, Cl2O7Cl_2O_7).

📐Formulae

ZeffZσZ_{eff} \approx Z - \sigma

X(g)X+(g)+e(ΔH=IE1)X(g) \rightarrow X^{+}(g) + e^{-} \quad (\Delta H = IE_{1})

X(g)+eX(g)(ΔH=EA1)X(g) + e^{-} \rightarrow X^{-}(g) \quad (\Delta H = EA_{1})

Na2O(s)+H2O(l)2NaOH(aq)Na_{2}O(s) + H_{2}O(l) \rightarrow 2NaOH(aq) (Basic Oxide)

P4O10(s)+6H2O(l)4H3PO4(aq)P_{4}O_{10}(s) + 6H_{2}O(l) \rightarrow 4H_{3}PO_{4}(aq) (Acidic Oxide)

Al2O3(s)+6HCl(aq)2AlCl3(aq)+3H2O(l)Al_{2}O_{3}(s) + 6HCl(aq) \rightarrow 2AlCl_{3}(aq) + 3H_{2}O(l) (Amphoteric Behavior)

💡Examples

Problem 1:

Explain why the first ionization energy of Aluminum (Z=13Z=13) is lower than that of Magnesium (Z=12Z=12).

Solution:

Mg:[Ne]3s2Mg: [Ne] 3s^{2} vs. Al:[Ne]3s23p1Al: [Ne] 3s^{2} 3p^{1}

Explanation:

The electron removed from AlAl is in the 3p3p subshell, which is at a higher energy level and further from the nucleus than the 3s3s subshell of MgMg. Additionally, the 3p3p electron is slightly shielded by the 3s23s^{2} electrons, making it easier to remove despite the higher nuclear charge of AlAl.

Problem 2:

Compare the atomic radius of PP and ClCl and justify the difference.

Solution:

Radius(P)>Radius(Cl)Radius(P) > Radius(Cl)

Explanation:

Both elements are in Period 3 and have electrons in the same principal energy level (n=3n=3). However, ClCl has more protons (Z=17Z=17) than PP (Z=15Z=15). This results in a higher effective nuclear charge (ZeffZ_{eff}) in ClCl, which pulls the outer electrons more strongly toward the nucleus, resulting in a smaller atomic radius.

Problem 3:

Identify the nature of the oxide formed by Sulfur and write its reaction with water.

Solution:

SO3(g)+H2O(l)H2SO4(aq)SO_{3}(g) + H_{2}O(l) \rightarrow H_{2}SO_{4}(aq)

Explanation:

Sulfur is a non-metal. Non-metal oxides are generally acidic. SO3SO_{3} reacts with water to form sulfuric acid (H2SO4H_{2}SO_{4}), which is a strong acid.

Periodic trends - Revision Notes & Key Formulas | IB Grade 11 Chemistry