krit.club logo

Hydrocarbons - Chemical Properties of Benzene and Electrophilic Substitution Reactions

Grade 11CBSEChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Benzene (C6H6C_6H_6) is an aromatic hydrocarbon characterized by a planar ring with delocalized π\pi electrons, making it highly stable due to resonance energy.

The primary chemical characteristic of Benzene is Electrophilic Substitution Reactions (SEArS_EAr), where an electrophile (E+E^+) replaces a hydrogen atom on the ring without disrupting the aromaticity.

The mechanism of electrophilic substitution involves three steps: (1) Generation of the electrophile, (2) Formation of a carbocation intermediate known as the sigma complex or arenium ion, and (3) Loss of a proton (H+H^+) from the carbocation to restore aromaticity.

Nitration: Benzene reacts with a mixture of concentrated HNO3HNO_3 and concentrated H2SO4H_2SO_4 (nitrating mixture) at 323333K323-333 K to form Nitrobenzene. The electrophile is the nitronium ion (NO2+NO_2^+).

Halogenation: Benzene reacts with halogens (Cl2Cl_2, Br2Br_2) in the presence of Lewis acids like anhydrous FeCl3FeCl_3, FeBr3FeBr_3, or AlCl3AlCl_3 to form haloarenes. The Lewis acid helps generate the halonium ion (e.g., Cl+Cl^+).

Sulphonation: The process of heating benzene with fuming sulphuric acid (H2SO4+SO3H_2SO_4 + SO_3) to produce Benzene sulphonic acid. The active electrophile is neutral SO3SO_3.

Friedel-Crafts Alkylation: Benzene reacts with an alkyl halide (RXR-X) in the presence of anhydrous AlCl3AlCl_3 to produce alkylbenzene. The electrophile is the carbocation (R+R^+).

Friedel-Crafts Acylation: Benzene reacts with an acyl halide (RCOClR-COCl) or acid anhydride in the presence of anhydrous AlCl3AlCl_3 to produce an acyl benzene (ketone). The electrophile is the acylium ion (RC+=OR-C^+=O).

Hückel's Rule: For a compound to be aromatic, it must be cyclic, planar, and possess (4n+2)π(4n + 2) \pi electrons, where nn is an integer (0,1,2,...0, 1, 2, ...).

📐Formulae

C6H6+HNO3H2SO4,323333KC6H5NO2+H2OC_6H_6 + HNO_3 \xrightarrow{H_2SO_4, 323-333K} C_6H_5NO_2 + H_2O

C6H6+Cl2Anhy.FeCl3C6H5Cl+HClC_6H_6 + Cl_2 \xrightarrow{Anhy. FeCl_3} C_6H_5Cl + HCl

C6H6+H2SO4(SO3)C6H5SO3H+H2OC_6H_6 + H_2SO_4 (SO_3) \rightarrow C_6H_5SO_3H + H_2O

C6H6+CH3ClAnhy.AlCl3C6H5CH3+HClC_6H_6 + CH_3Cl \xrightarrow{Anhy. AlCl_3} C_6H_5CH_3 + HCl

C6H6+CH3COClAnhy.AlCl3C6H5COCH3+HClC_6H_6 + CH_3COCl \xrightarrow{Anhy. AlCl_3} C_6H_5COCH_3 + HCl

Hu¨ckel’s Rule: (4n+2)π electrons\text{Hückel's Rule: } (4n + 2) \pi \text{ electrons}

💡Examples

Problem 1:

Predict the product formed when Benzene reacts with CH3CH2COClCH_3CH_2COCl in the presence of anhydrous AlCl3AlCl_3. Provide the name of the reaction.

Solution:

The product is Propiophenone (or 1-phenylpropan-1-one), represented by the formula C6H5COCH2CH3C_6H_5COCH_2CH_3. The reaction is Friedel-Crafts Acylation.

Explanation:

In this reaction, the Lewis acid AlCl3AlCl_3 reacts with the acyl halide to generate the propionylium electrophile (CH3CH2C+=OCH_3CH_2C^+=O). This electrophile attacks the benzene ring, substituting a hydrogen atom to form the ketone.

Problem 2:

Explain why Benzene does not undergo addition reactions easily despite having three double bonds.

Solution:

Benzene is stabilized by resonance energy (approx. 150 kJ/mol150 \text{ kJ/mol}). Addition reactions would break the delocalized π\pi electron system and destroy the aromatic character, which is energetically unfavorable.

Explanation:

The (4n+2)π(4n+2) \pi electron system provides extra stability. Substitution reactions allow the benzene ring to retain its aromatic stability, whereas addition would result in a less stable non-aromatic product.

Problem 3:

Identify the electrophile in the Nitration of Benzene and show how it is generated.

Solution:

The electrophile is the nitronium ion (NO2+NO_2^+). It is generated as: HNO3+2H2SO4NO2++H3O++2HSO4HNO_3 + 2H_2SO_4 \rightleftharpoons NO_2^+ + H_3O^+ + 2HSO_4^-

Explanation:

In this acid-base reaction, H2SO4H_2SO_4 (the stronger acid) protonates HNO3HNO_3. The subsequent loss of a water molecule from protonated nitric acid creates the NO2+NO_2^+ ion.

Chemical Properties of Benzene and Electrophilic Substitution Reactions Revision - Class 11…