krit.club logo

Hydrocarbons - Alkenes - Nomenclature, Structure of Double Bond, Geometrical Isomerism, Preparation and Properties

Grade 11CBSEChemistry

Review the key concepts, formulae, and examples before starting your quiz.

🔑Concepts

Alkenes are unsaturated hydrocarbons containing at least one double bond, with the general formula CnH2nC_nH_{2n}.

Structure of Double Bond: The carbon atoms in a double bond are sp2sp^2 hybridized. The double bond consists of one strong σ\sigma bond (formed by head-on overlap of sp2sp^2 orbitals) and one weak π\pi bond (formed by lateral overlap of unhybridized 2p2p orbitals). The bond angle is approximately 120120^\circ.

Geometrical Isomerism: Due to restricted rotation around the C=CC=C bond, alkenes exhibit cistranscis-trans isomerism. In the ciscis isomer, identical groups are on the same side, while in the transtrans isomer, they are on opposite sides. TransTrans isomers are generally more stable and have lower dipole moments than ciscis isomers.

Preparation Methods: Alkenes can be prepared via Dehydrohalogenation of alkyl halides (using alcoholic KOHKOH), Dehydration of alcohols (using conc. H2SO4H_2SO_4 at 443K443K), and Controlled hydrogenation of alkynes (using Lindlar's catalyst for ciscis-alkenes or Na/liq.NH3Na/liq. NH_3 for transtrans-alkenes).

Markovnikov's Rule: During the addition of a polar reagent like HXHX to an unsymmetrical alkene, the negative part of the addendum (XX^-) attaches to the carbon atom possessing the lesser number of hydrogen atoms.

Anti-Markovnikov Addition (Peroxide Effect): In the presence of peroxides, the addition of HBrHBr (not HClHCl or HIHI) to unsymmetrical alkenes follows the anti-Markovnikov path, where the BrBr attaches to the carbon with more hydrogen atoms.

Ozonolysis: Alkenes react with ozone (O3O_3) to form ozonides, which undergo reductive cleavage with Zn/H2OZn/H_2O to produce aldehydes and/or ketones. This reaction is used to locate the position of the double bond.

📐Formulae

CnH2nC_nH_{2n}

CH3CH2OHconc.H2SO4,443KCH2=CH2+H2OCH_3CH_2OH \xrightarrow{conc. H_2SO_4, 443K} CH_2=CH_2 + H_2O

RCH(X)CH3+KOH(alc)ΔRCH=CH2+KX+H2OR-CH(X)-CH_3 + KOH(alc) \xrightarrow{\Delta} R-CH=CH_2 + KX + H_2O

RCCR+H2Pd/C,CaCO3(Lindlars)cisalkeneR-C \equiv C-R + H_2 \xrightarrow{Pd/C, CaCO_3 (Lindlar's)} cis-alkene

CH3CH=CH2+HBrnoperoxideCH3CH(Br)CH3CH_3-CH=CH_2 + HBr \xrightarrow{no peroxide} CH_3-CH(Br)-CH_3

CH3CH=CH2+HBrperoxideCH3CH2CH2BrCH_3-CH=CH_2 + HBr \xrightarrow{peroxide} CH_3-CH_2-CH_2Br

💡Examples

Problem 1:

An alkene 'A' on ozonolysis gives a mixture of ethanalethanal (CH3CHOCH_3CHO) and propanonepropanone (CH3COCH3CH_3COCH_3). Write the structure and IUPAC name of 'A'.

Solution:

Structure of A: (CH3)2C=CHCH3(CH_3)_2C=CH-CH_3. IUPAC Name: 2methylbut2ene2-methylbut-2-ene.

Explanation:

In ozonolysis, the C=CC=C bond is cleaved and replaced by C=OC=O bonds. By placing the carbonyl carbons of the products together and removing the oxygens, we reconstruct the alkene: CH3C(CH3)=O+O=CHCH3CH3C(CH3)=CHCH3CH_3-C(CH_3)=O + O=CH-CH_3 \rightarrow CH_3-C(CH_3)=CH-CH_3.

Problem 2:

Identify the major product when propenepropene reacts with HBrHBr in the presence of benzoyl peroxide.

Solution:

1bromopropane1-bromopropane (CH3CH2CH2BrCH_3-CH_2-CH_2Br)

Explanation:

This reaction follows the Anti-Markovnikov rule due to the presence of peroxide (Kharasch effect). The bromine radical attacks the terminal carbon to form a more stable secondary free radical intermediate, leading to the terminal halide.

Problem 3:

Which of the following shows geometrical isomerism: but1enebut-1-ene or but2enebut-2-ene?

Solution:

but2enebut-2-ene shows geometrical isomerism (ciscis and transtrans).

Explanation:

For geometrical isomerism, each carbon of the double bond must be attached to two different groups. In but1enebut-1-ene (CH2=CHCH2CH3CH_2=CH-CH_2-CH_3), the first carbon has two identical hydrogen atoms. In but2enebut-2-ene (CH3CH=CHCH3CH_3-CH=CH-CH_3), each carbon is attached to one HH and one CH3CH_3, allowing for ciscis and transtrans arrangements.